About 2-ethyl-N,N-dimethylundecan-1-amine
2-ethyl-N,N-dimethylundecan-1-amine (PubChem CID 87794341) has the molecular formula C15H33N
and a molecular weight of 227.44 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethylundecan-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-N,N-dimethylundecan-1-amine |
| PubChem CID | 87794341 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 2-ethyl-N,N-dimethylundecan-1-amine |
| SMILES | CCCCCCCCCC(CC)CN(C)C |
| InChI | InChI=1S/C15H33N/c1-5-7-8-9-10-11-12-13-15(6-2)14-16(3)4/h15H,5-14H2,1-4H3 |
| InChIKey | UTFWDUAPNPFGGW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N,N-dimethylundecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-dimethylundecan-1-amine?
The IUPAC name of 2-ethyl-N,N-dimethylundecan-1-amine (CID 87794341) is 2-ethyl-N,N-dimethylundecan-1-amine.
What is the SMILES notation for 2-ethyl-N,N-dimethylundecan-1-amine?
The canonical SMILES for 2-ethyl-N,N-dimethylundecan-1-amine is CCCCCCCCCC(CC)CN(C)C.
What is the InChIKey of 2-ethyl-N,N-dimethylundecan-1-amine?
The InChIKey is UTFWDUAPNPFGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N/c1-5-7-8-9-10-11-12-13-15(6-2)14-16(3)4/h15H,5-14H2,1-4H3.
What are the key properties of 2-ethyl-N,N-dimethylundecan-1-amine?
2-ethyl-N,N-dimethylundecan-1-amine has a molecular weight of 227.44 g/mol, XLogP of 4.71, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-dimethylundecan-1-amine is sourced from PubChem (CID 87794341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).