About 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene
2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene (PubChem CID 142067744) has the molecular formula C19H41N
and a molecular weight of 283.54 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene.
Molecular Properties
| Compound Name | 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene |
| PubChem CID | 142067744 |
| Molecular Formula | C19H41N |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.32 |
| IUPAC Name | 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene |
| SMILES | CC=C(C)C.CCCCCCCCC(CC)CN(C)C |
| InChI | InChI=1S/C14H31N.C5H10/c1-5-7-8-9-10-11-12-14(6-2)13-15(3)4;1-4-5(2)3/h14H,5-13H2,1-4H3;4H,1-3H3 |
| InChIKey | VZPBMNRITFXRLW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene?
The IUPAC name of 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene (CID 142067744) is 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene.
What is the SMILES notation for 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene?
The canonical SMILES for 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene is CC=C(C)C.CCCCCCCCC(CC)CN(C)C.
What is the InChIKey of 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene?
The InChIKey is VZPBMNRITFXRLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.C5H10/c1-5-7-8-9-10-11-12-14(6-2)13-15(3)4;1-4-5(2)3/h14H,5-13H2,1-4H3;4H,1-3H3.
What are the key properties of 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene?
2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene has a molecular weight of 283.54 g/mol, XLogP of 6.30, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-dimethyldecan-1-amine;2-methylbut-2-ene is sourced from PubChem (CID 142067744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).