C19H42N2 — CID 23135069
1-N',1-N'-bis(2-ethylhexyl)propane-1,1-diamine (PubChem CID 23135069) has the molecular formula C19H42N2 and a molecular weight of 298.56 g/mol. Its IUPAC name is 1-N',1-N'-bis(2-ethylhexyl)propane-1,1-diamine.
| Compound Name | 1-N',1-N'-bis(2-ethylhexyl)propane-1,1-diamine |
|---|---|
| PubChem CID | 23135069 |
| Molecular Formula | C19H42N2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.33 |
| IUPAC Name | 1-N',1-N'-bis(2-ethylhexyl)propane-1,1-diamine |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(N)CC |
| InChI | InChI=1S/C19H42N2/c1-6-11-13-17(8-3)15-21(19(20)10-5)16-18(9-4)14-12-7-2/h17-19H,6-16,20H2,1-5H3 |
| InChIKey | ZLXYJNYZIZNQKW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|