C12H26ClN — CID 63386988
N-(2-chloroethyl)-N,2-diethylhexan-1-amine (PubChem CID 63386988) has the molecular formula C12H26ClN and a molecular weight of 219.80 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,2-diethylhexan-1-amine.
| Compound Name | N-(2-chloroethyl)-N,2-diethylhexan-1-amine |
|---|---|
| PubChem CID | 63386988 |
| Molecular Formula | C12H26ClN |
| Molecular Weight | 219.80 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | N-(2-chloroethyl)-N,2-diethylhexan-1-amine |
| SMILES | CCCCC(CC)CN(CC)CCCl |
| InChI | InChI=1S/C12H26ClN/c1-4-7-8-12(5-2)11-14(6-3)10-9-13/h12H,4-11H2,1-3H3 |
| InChIKey | HYLSDJXPXAVPIN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|