C12H29N3 — CID 105244694
4-ethyl-2-hydrazinyl-N,N-dimethyloctan-1-amine (PubChem CID 105244694) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is 4-ethyl-2-hydrazinyl-N,N-dimethyloctan-1-amine.
| Compound Name | 4-ethyl-2-hydrazinyl-N,N-dimethyloctan-1-amine |
|---|---|
| PubChem CID | 105244694 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | 4-ethyl-2-hydrazinyl-N,N-dimethyloctan-1-amine |
| SMILES | CCCCC(CC)CC(CN(C)C)NN |
| InChI | InChI=1S/C12H29N3/c1-5-7-8-11(6-2)9-12(14-13)10-15(3)4/h11-12,14H,5-10,13H2,1-4H3 |
| InChIKey | SURFPJPMUBAZGB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|