C10H24N2 — CID 79092726
2-N-ethyl-1-N,1-N-dimethylhexane-1,2-diamine (PubChem CID 79092726) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 2-N-ethyl-1-N,1-N-dimethylhexane-1,2-diamine.
| Compound Name | 2-N-ethyl-1-N,1-N-dimethylhexane-1,2-diamine |
|---|---|
| PubChem CID | 79092726 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 2-N-ethyl-1-N,1-N-dimethylhexane-1,2-diamine |
| SMILES | CCCCC(CN(C)C)NCC |
| InChI | InChI=1S/C10H24N2/c1-5-7-8-10(11-6-2)9-12(3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | HMVUPCDDZSXDPT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |