C17H38N2 — CID 79089113
1-N,1-N-dimethyl-2-N-propyldodecane-1,2-diamine (PubChem CID 79089113) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-2-N-propyldodecane-1,2-diamine.
| Compound Name | 1-N,1-N-dimethyl-2-N-propyldodecane-1,2-diamine |
|---|---|
| PubChem CID | 79089113 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 1-N,1-N-dimethyl-2-N-propyldodecane-1,2-diamine |
| SMILES | CCCCCCCCCCC(CN(C)C)NCCC |
| InChI | InChI=1S/C17H38N2/c1-5-7-8-9-10-11-12-13-14-17(16-19(3)4)18-15-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | CKJBRUVYHPEWCS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|