C10H25N3 — CID 105244954
2-hydrazinyl-N,N,6-trimethylheptan-1-amine (PubChem CID 105244954) has the molecular formula C10H25N3 and a molecular weight of 187.33 g/mol. Its IUPAC name is 2-hydrazinyl-N,N,6-trimethylheptan-1-amine.
| Compound Name | 2-hydrazinyl-N,N,6-trimethylheptan-1-amine |
|---|---|
| PubChem CID | 105244954 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 2-hydrazinyl-N,N,6-trimethylheptan-1-amine |
| SMILES | CC(C)CCCC(CN(C)C)NN |
| InChI | InChI=1S/C10H25N3/c1-9(2)6-5-7-10(12-11)8-13(3)4/h9-10,12H,5-8,11H2,1-4H3 |
| InChIKey | PXOOOBYSOQFZRY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|