C14H33N3 — CID 105241898
3-ethyl-4-hydrazinyl-N,N,8-trimethylnonan-3-amine (PubChem CID 105241898) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is 3-ethyl-4-hydrazinyl-N,N,8-trimethylnonan-3-amine.
| Compound Name | 3-ethyl-4-hydrazinyl-N,N,8-trimethylnonan-3-amine |
|---|---|
| PubChem CID | 105241898 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | 3-ethyl-4-hydrazinyl-N,N,8-trimethylnonan-3-amine |
| SMILES | CCC(CC)(C(CCCC(C)C)NN)N(C)C |
| InChI | InChI=1S/C14H33N3/c1-7-14(8-2,17(5)6)13(16-15)11-9-10-12(3)4/h12-13,16H,7-11,15H2,1-6H3 |
| InChIKey | SPJCFXKHZXDKHU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|