C13H30N2 — CID 79062379
3-ethyl-3-N,3-N,4-N,6-tetramethylheptane-3,4-diamine (PubChem CID 79062379) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 3-ethyl-3-N,3-N,4-N,6-tetramethylheptane-3,4-diamine.
| Compound Name | 3-ethyl-3-N,3-N,4-N,6-tetramethylheptane-3,4-diamine |
|---|---|
| PubChem CID | 79062379 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 3-ethyl-3-N,3-N,4-N,6-tetramethylheptane-3,4-diamine |
| SMILES | CCC(CC)(C(CC(C)C)NC)N(C)C |
| InChI | InChI=1S/C13H30N2/c1-8-13(9-2,15(6)7)12(14-5)10-11(3)4/h11-12,14H,8-10H2,1-7H3 |
| InChIKey | JNGRUQZQLRGIRL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |