C15H34N2 — CID 79061055
3-ethyl-3-N,3-N-dimethyl-4-N-propyloctane-3,4-diamine (PubChem CID 79061055) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 3-ethyl-3-N,3-N-dimethyl-4-N-propyloctane-3,4-diamine.
| Compound Name | 3-ethyl-3-N,3-N-dimethyl-4-N-propyloctane-3,4-diamine |
|---|---|
| PubChem CID | 79061055 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | 3-ethyl-3-N,3-N-dimethyl-4-N-propyloctane-3,4-diamine |
| SMILES | CCCCC(NCCC)C(CC)(CC)N(C)C |
| InChI | InChI=1S/C15H34N2/c1-7-11-12-14(16-13-8-2)15(9-3,10-4)17(5)6/h14,16H,7-13H2,1-6H3 |
| InChIKey | QZSZRKFMBUPBPL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |