C15H32N2 — CID 79186670
3-ethyl-3-N,3-N,6-trimethyl-4-N-propylhept-6-ene-3,4-diamine (PubChem CID 79186670) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 3-ethyl-3-N,3-N,6-trimethyl-4-N-propylhept-6-ene-3,4-diamine.
| Compound Name | 3-ethyl-3-N,3-N,6-trimethyl-4-N-propylhept-6-ene-3,4-diamine |
|---|---|
| PubChem CID | 79186670 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 3-ethyl-3-N,3-N,6-trimethyl-4-N-propylhept-6-ene-3,4-diamine |
| SMILES | C=C(C)CC(NCCC)C(CC)(CC)N(C)C |
| InChI | InChI=1S/C15H32N2/c1-8-11-16-14(12-13(4)5)15(9-2,10-3)17(6)7/h14,16H,4,8-12H2,1-3,5-7H3 |
| InChIKey | MLTKXUWDKIHDAG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|