C24H53N3 — CID 21469942
6-N-(2-aminoethyl)-5-N,5-N,5-tributyldecane-5,6-diamine (PubChem CID 21469942) has the molecular formula C24H53N3 and a molecular weight of 383.71 g/mol. Its IUPAC name is 6-N-(2-aminoethyl)-5-N,5-N,5-tributyldecane-5,6-diamine.
| Compound Name | 6-N-(2-aminoethyl)-5-N,5-N,5-tributyldecane-5,6-diamine |
|---|---|
| PubChem CID | 21469942 |
| Molecular Formula | C24H53N3 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 383.42 |
| IUPAC Name | 6-N-(2-aminoethyl)-5-N,5-N,5-tributyldecane-5,6-diamine |
| SMILES | CCCCC(NCCN)C(CCCC)(CCCC)N(CCCC)CCCC |
| InChI | InChI=1S/C24H53N3/c1-6-11-16-23(26-20-19-25)24(17-12-7-2,18-13-8-3)27(21-14-9-4)22-15-10-5/h23,26H,6-22,25H2,1-5H3 |
| InChIKey | QQPRIIGEJVOEPN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |