C28H62N4 — CID 151707623
1-N',1-N',1-N",1-N"-tetrabutyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine (PubChem CID 151707623) has the molecular formula C28H62N4 and a molecular weight of 454.83 g/mol. Its IUPAC name is 1-N',1-N',1-N",1-N"-tetrabutyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine.
| Compound Name | 1-N',1-N',1-N",1-N"-tetrabutyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 151707623 |
| Molecular Formula | C28H62N4 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 454.50 |
| IUPAC Name | 1-N',1-N',1-N",1-N"-tetrabutyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine |
| SMILES | CCCCCCCCC(NC)C(NC)(N(CCCC)CCCC)N(CCCC)CCCC |
| InChI | InChI=1S/C28H62N4/c1-8-13-18-19-20-21-22-27(29-6)28(30-7,31(23-14-9-2)24-15-10-3)32(25-16-11-4)26-17-12-5/h27,29-30H,8-26H2,1-7H3 |
| InChIKey | RFXCMLSBEBJEBJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|