C21H45N — CID 175088572
N,N,5-tributylnonan-5-amine (PubChem CID 175088572) has the molecular formula C21H45N and a molecular weight of 311.60 g/mol. Its IUPAC name is N,N,5-tributylnonan-5-amine.
| Compound Name | N,N,5-tributylnonan-5-amine |
|---|---|
| PubChem CID | 175088572 |
| Molecular Formula | C21H45N |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 311.36 |
| IUPAC Name | N,N,5-tributylnonan-5-amine |
| SMILES | CCCCN(CCCC)C(CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C21H45N/c1-6-11-16-21(17-12-7-2,18-13-8-3)22(19-14-9-4)20-15-10-5/h6-20H2,1-5H3 |
| InChIKey | JXVPYDUMLBTWMZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |