C10H23N — CID 11062646
N,N-di(propan-2-yl)butan-1-amine (PubChem CID 11062646) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is N,N-di(propan-2-yl)butan-1-amine.
| Compound Name | N,N-di(propan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 11062646 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | N,N-di(propan-2-yl)butan-1-amine |
| SMILES | CCCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C10H23N/c1-6-7-8-11(9(2)3)10(4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | KLVOSHOFGYMCCP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |