C23H49N — CID 138744995
N,N-di(propan-2-yl)heptadecan-1-amine (PubChem CID 138744995) has the molecular formula C23H49N and a molecular weight of 339.65 g/mol. Its IUPAC name is N,N-di(propan-2-yl)heptadecan-1-amine.
| Compound Name | N,N-di(propan-2-yl)heptadecan-1-amine |
|---|---|
| PubChem CID | 138744995 |
| Molecular Formula | C23H49N |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 339.39 |
| IUPAC Name | N,N-di(propan-2-yl)heptadecan-1-amine |
| SMILES | CCCCCCCCCCCCCCCCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C23H49N/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(22(2)3)23(4)5/h22-23H,6-21H2,1-5H3 |
| InChIKey | SQISLXGMFSPUTO-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|