C17H38NO6P3 — CID 135291805
N,N-di(propan-2-yl)-5-(2,4,6-trioxo-4,6-dipropyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)pentan-1-amine (PubChem CID 135291805) has the molecular formula C17H38NO6P3 and a molecular weight of 445.41 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-5-(2,4,6-trioxo-4,6-dipropyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)pentan-1-amine.
| Compound Name | N,N-di(propan-2-yl)-5-(2,4,6-trioxo-4,6-dipropyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 135291805 |
| Molecular Formula | C17H38NO6P3 |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N,N-di(propan-2-yl)-5-(2,4,6-trioxo-4,6-dipropyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)pentan-1-amine |
| SMILES | CCCP1(=O)OP(=O)(CCC)OP(=O)(CCCCCN(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C17H38NO6P3/c1-7-13-25(19)22-26(20,14-8-2)24-27(21,23-25)15-11-9-10-12-18(16(3)4)17(5)6/h16-17H,7-15H2,1-6H3 |
| InChIKey | RQRVYNHJPYVUNS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|