C7H17O6P3 — CID 166945501
2,4-diethyl-6-propyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide (PubChem CID 166945501) has the molecular formula C7H17O6P3 and a molecular weight of 290.13 g/mol. Its IUPAC name is 2,4-diethyl-6-propyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide.
| Compound Name | 2,4-diethyl-6-propyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
|---|---|
| PubChem CID | 166945501 |
| Molecular Formula | C7H17O6P3 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2,4-diethyl-6-propyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
| SMILES | CCCP1(=O)OP(=O)(CC)OP(=O)(CC)O1 |
| InChI | InChI=1S/C7H17O6P3/c1-4-7-16(10)12-14(8,5-2)11-15(9,6-3)13-16/h4-7H2,1-3H3 |
| InChIKey | SYRCJIFCCQZWBV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|