About methoxy(trimethyl)silane;propoxy(tripropyl)silane
methoxy(trimethyl)silane;propoxy(tripropyl)silane (PubChem CID 141486227) has the molecular formula C16H40O2Si2
and a molecular weight of 320.67 g/mol. Its IUPAC name is methoxy(trimethyl)silane;propoxy(tripropyl)silane.
Molecular Properties
| Compound Name | methoxy(trimethyl)silane;propoxy(tripropyl)silane |
| PubChem CID | 141486227 |
| Molecular Formula | C16H40O2Si2 |
| Molecular Weight | 320.67 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | methoxy(trimethyl)silane;propoxy(tripropyl)silane |
| SMILES | CCCO[Si](CCC)(CCC)CCC.CO[Si](C)(C)C |
| InChI | InChI=1S/C12H28OSi.C4H12OSi/c1-5-9-13-14(10-6-2,11-7-3)12-8-4;1-5-6(2,3)4/h5-12H2,1-4H3;1-4H3 |
| InChIKey | BVSTUOIYBXLNSB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methoxy(trimethyl)silane;propoxy(tripropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(trimethyl)silane;propoxy(tripropyl)silane?
The IUPAC name of methoxy(trimethyl)silane;propoxy(tripropyl)silane (CID 141486227) is methoxy(trimethyl)silane;propoxy(tripropyl)silane.
What is the SMILES notation for methoxy(trimethyl)silane;propoxy(tripropyl)silane?
The canonical SMILES for methoxy(trimethyl)silane;propoxy(tripropyl)silane is CCCO[Si](CCC)(CCC)CCC.CO[Si](C)(C)C.
What is the InChIKey of methoxy(trimethyl)silane;propoxy(tripropyl)silane?
The InChIKey is BVSTUOIYBXLNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28OSi.C4H12OSi/c1-5-9-13-14(10-6-2,11-7-3)12-8-4;1-5-6(2,3)4/h5-12H2,1-4H3;1-4H3.
What are the key properties of methoxy(trimethyl)silane;propoxy(tripropyl)silane?
methoxy(trimethyl)silane;propoxy(tripropyl)silane has a molecular weight of 320.67 g/mol, XLogP of 6.06, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(trimethyl)silane;propoxy(tripropyl)silane is sourced from PubChem (CID 141486227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).