C6H15O9P3 — CID 141080121
2-hexoxy-4,6-dihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide (PubChem CID 141080121) has the molecular formula C6H15O9P3 and a molecular weight of 324.10 g/mol. Its IUPAC name is 2-hexoxy-4,6-dihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide.
| Compound Name | 2-hexoxy-4,6-dihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
|---|---|
| PubChem CID | 141080121 |
| Molecular Formula | C6H15O9P3 |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 2-hexoxy-4,6-dihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
| SMILES | CCCCCCOP1(=O)OP(=O)(O)OP(=O)(O)O1 |
| InChI | InChI=1S/C6H15O9P3/c1-2-3-4-5-6-12-18(11)14-16(7,8)13-17(9,10)15-18/h2-6H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | WCACZNOTNBTFPM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|