C12H25O4PS — CID 70636781
4-dodecoxy-1,3,2,4λ5-dioxathiaphosphetane 4-oxide (PubChem CID 70636781) has the molecular formula C12H25O4PS and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-dodecoxy-1,3,2,4λ5-dioxathiaphosphetane 4-oxide.
| Compound Name | 4-dodecoxy-1,3,2,4λ5-dioxathiaphosphetane 4-oxide |
|---|---|
| PubChem CID | 70636781 |
| Molecular Formula | C12H25O4PS |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-dodecoxy-1,3,2,4λ5-dioxathiaphosphetane 4-oxide |
| SMILES | CCCCCCCCCCCCOP1(=O)OSO1 |
| InChI | InChI=1S/C12H25O4PS/c1-2-3-4-5-6-7-8-9-10-11-12-14-17(13)15-18-16-17/h2-12H2,1H3 |
| InChIKey | MKWVSCVHPDJYNG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|