CH7O10P3 — CID 174239066
methanol;2,4,6-trihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide (PubChem CID 174239066) has the molecular formula CH7O10P3 and a molecular weight of 271.98 g/mol. Its IUPAC name is methanol;2,4,6-trihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide.
| Compound Name | methanol;2,4,6-trihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
|---|---|
| PubChem CID | 174239066 |
| Molecular Formula | CH7O10P3 |
| Molecular Weight | 271.98 g/mol |
| Exact Mass | 271.93 |
| IUPAC Name | methanol;2,4,6-trihydroxy-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
| SMILES | CO.O=P1(O)OP(=O)(O)OP(=O)(O)O1 |
| InChI | InChI=1S/CH4O.H3O9P3/c1-2;1-10(2)7-11(3,4)9-12(5,6)8-10/h2H,1H3;(H,1,2)(H,3,4)(H,5,6) |
| InChIKey | PKRDYWWPVSJMII-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.98 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|