CH2O8P2 — CID 141425610
2,6-dihydroxy-1,3,5,7-tetraoxa-2λ5,6λ5-diphosphaspiro[3.3]heptane 2,6-dioxide (PubChem CID 141425610) has the molecular formula CH2O8P2 and a molecular weight of 203.97 g/mol. Its IUPAC name is 2,6-dihydroxy-1,3,5,7-tetraoxa-2λ5,6λ5-diphosphaspiro[3.3]heptane 2,6-dioxide.
| Compound Name | 2,6-dihydroxy-1,3,5,7-tetraoxa-2λ5,6λ5-diphosphaspiro[3.3]heptane 2,6-dioxide |
|---|---|
| PubChem CID | 141425610 |
| Molecular Formula | CH2O8P2 |
| Molecular Weight | 203.97 g/mol |
| Exact Mass | 203.92 |
| IUPAC Name | 2,6-dihydroxy-1,3,5,7-tetraoxa-2λ5,6λ5-diphosphaspiro[3.3]heptane 2,6-dioxide |
| SMILES | O=P1(O)OC2(O1)OP(=O)(O)O2 |
| InChI | InChI=1S/CH2O8P2/c2-10(3)6-1(7-10)8-11(4,5)9-1/h(H,2,3)(H,4,5) |
| InChIKey | HMZYBCRBGVTJCM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.97 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|