C9H19O4P — CID 154259848
2-hydroxy-1,3-dioxa-2λ5-phosphacyclododecane 2-oxide (PubChem CID 154259848) has the molecular formula C9H19O4P and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-hydroxy-1,3-dioxa-2λ5-phosphacyclododecane 2-oxide.
| Compound Name | 2-hydroxy-1,3-dioxa-2λ5-phosphacyclododecane 2-oxide |
|---|---|
| PubChem CID | 154259848 |
| Molecular Formula | C9H19O4P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-hydroxy-1,3-dioxa-2λ5-phosphacyclododecane 2-oxide |
| SMILES | O=P1(O)OCCCCCCCCCO1 |
| InChI | InChI=1S/C9H19O4P/c10-14(11)12-8-6-4-2-1-3-5-7-9-13-14/h1-9H2,(H,10,11) |
| InChIKey | DKVOUFTVWIUJFR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|