About 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide
2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide (PubChem CID 12579739) has the molecular formula C6H13O3P
and a molecular weight of 164.14 g/mol. Its IUPAC name is 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide.
Molecular Properties
| Compound Name | 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide |
| PubChem CID | 12579739 |
| Molecular Formula | C6H13O3P |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide |
| SMILES | CP1(=O)OCCCCCO1 |
| InChI | InChI=1S/C6H13O3P/c1-10(7)8-5-3-2-4-6-9-10/h2-6H2,1H3 |
| InChIKey | PORBPPWYMDQLSU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide?
The IUPAC name of 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide (CID 12579739) is 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide.
What is the SMILES notation for 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide?
The canonical SMILES for 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide is CP1(=O)OCCCCCO1.
What is the InChIKey of 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide?
The InChIKey is PORBPPWYMDQLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O3P/c1-10(7)8-5-3-2-4-6-9-10/h2-6H2,1H3.
What are the key properties of 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide?
2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide has a molecular weight of 164.14 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3,2lambda5-dioxaphosphocane 2-oxide is sourced from PubChem (CID 12579739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).