C9H19O3P — CID 170747154
ethane;7-methyl-6,8-dioxa-7λ5-phosphaspiro[3.5]nonane 7-oxide (PubChem CID 170747154) has the molecular formula C9H19O3P and a molecular weight of 206.22 g/mol. Its IUPAC name is ethane;7-methyl-6,8-dioxa-7λ5-phosphaspiro[3.5]nonane 7-oxide.
| Compound Name | ethane;7-methyl-6,8-dioxa-7λ5-phosphaspiro[3.5]nonane 7-oxide |
|---|---|
| PubChem CID | 170747154 |
| Molecular Formula | C9H19O3P |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethane;7-methyl-6,8-dioxa-7λ5-phosphaspiro[3.5]nonane 7-oxide |
| SMILES | CC.CP1(=O)OCC2(CCC2)CO1 |
| InChI | InChI=1S/C7H13O3P.C2H6/c1-11(8)9-5-7(6-10-11)3-2-4-7;1-2/h2-6H2,1H3;1-2H3 |
| InChIKey | UTUIJWQKERMUTO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|