About spiro[2.4]heptane;spiro[3.4]octane
spiro[2.4]heptane;spiro[3.4]octane (PubChem CID 145351897) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is spiro[2.4]heptane;spiro[3.4]octane.
Molecular Properties
| Compound Name | spiro[2.4]heptane;spiro[3.4]octane |
| PubChem CID | 145351897 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | spiro[2.4]heptane;spiro[3.4]octane |
| SMILES | C1CCC2(C1)CC2.C1CCC2(C1)CCC2 |
| InChI | InChI=1S/C8H14.C7H12/c1-2-5-8(4-1)6-3-7-8;1-2-4-7(3-1)5-6-7/h1-7H2;1-6H2 |
| InChIKey | MADIJZMKBJUVQS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[2.4]heptane;spiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.4]heptane;spiro[3.4]octane?
The IUPAC name of spiro[2.4]heptane;spiro[3.4]octane (CID 145351897) is spiro[2.4]heptane;spiro[3.4]octane.
What is the SMILES notation for spiro[2.4]heptane;spiro[3.4]octane?
The canonical SMILES for spiro[2.4]heptane;spiro[3.4]octane is C1CCC2(C1)CC2.C1CCC2(C1)CCC2.
What is the InChIKey of spiro[2.4]heptane;spiro[3.4]octane?
The InChIKey is MADIJZMKBJUVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C7H12/c1-2-5-8(4-1)6-3-7-8;1-2-4-7(3-1)5-6-7/h1-7H2;1-6H2.
What are the key properties of spiro[2.4]heptane;spiro[3.4]octane?
spiro[2.4]heptane;spiro[3.4]octane has a molecular weight of 206.37 g/mol, XLogP of 5.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.4]heptane;spiro[3.4]octane is sourced from PubChem (CID 145351897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).