About methane;spiro[3.3]heptane
methane;spiro[3.3]heptane (PubChem CID 142516352) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is methane;spiro[3.3]heptane.
Molecular Properties
| Compound Name | methane;spiro[3.3]heptane |
| PubChem CID | 142516352 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | methane;spiro[3.3]heptane |
| SMILES | C.C1CC2(C1)CCC2 |
| InChI | InChI=1S/C7H12.CH4/c1-3-7(4-1)5-2-6-7;/h1-6H2;1H4 |
| InChIKey | ZIJUKFBOMUATKH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;spiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;spiro[3.3]heptane?
The IUPAC name of methane;spiro[3.3]heptane (CID 142516352) is methane;spiro[3.3]heptane.
What is the SMILES notation for methane;spiro[3.3]heptane?
The canonical SMILES for methane;spiro[3.3]heptane is C.C1CC2(C1)CCC2.
What is the InChIKey of methane;spiro[3.3]heptane?
The InChIKey is ZIJUKFBOMUATKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.CH4/c1-3-7(4-1)5-2-6-7;/h1-6H2;1H4.
What are the key properties of methane;spiro[3.3]heptane?
methane;spiro[3.3]heptane has a molecular weight of 112.22 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;spiro[3.3]heptane is sourced from PubChem (CID 142516352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).