About 7-iodospiro[3.5]nonane
7-iodospiro[3.5]nonane (PubChem CID 121454581) has the molecular formula C9H15I
and a molecular weight of 250.12 g/mol. Its IUPAC name is 7-iodospiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-iodospiro[3.5]nonane |
| PubChem CID | 121454581 |
| Molecular Formula | C9H15I |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 7-iodospiro[3.5]nonane |
| SMILES | IC1CCC2(CCC2)CC1 |
| InChI | InChI=1S/C9H15I/c10-8-2-6-9(7-3-8)4-1-5-9/h8H,1-7H2 |
| InChIKey | JJXGDNUTPIGDSQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodospiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodospiro[3.5]nonane?
The IUPAC name of 7-iodospiro[3.5]nonane (CID 121454581) is 7-iodospiro[3.5]nonane.
What is the SMILES notation for 7-iodospiro[3.5]nonane?
The canonical SMILES for 7-iodospiro[3.5]nonane is IC1CCC2(CCC2)CC1.
What is the InChIKey of 7-iodospiro[3.5]nonane?
The InChIKey is JJXGDNUTPIGDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15I/c10-8-2-6-9(7-3-8)4-1-5-9/h8H,1-7H2.
What are the key properties of 7-iodospiro[3.5]nonane?
7-iodospiro[3.5]nonane has a molecular weight of 250.12 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodospiro[3.5]nonane is sourced from PubChem (CID 121454581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).