About 7-propylspiro[3.5]nonane
7-propylspiro[3.5]nonane (PubChem CID 144910869) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is 7-propylspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-propylspiro[3.5]nonane |
| PubChem CID | 144910869 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 7-propylspiro[3.5]nonane |
| SMILES | CCCC1CCC2(CCC2)CC1 |
| InChI | InChI=1S/C12H22/c1-2-4-11-5-9-12(10-6-11)7-3-8-12/h11H,2-10H2,1H3 |
| InChIKey | RNUMXNNSBBKWIN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-propylspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propylspiro[3.5]nonane?
The IUPAC name of 7-propylspiro[3.5]nonane (CID 144910869) is 7-propylspiro[3.5]nonane.
What is the SMILES notation for 7-propylspiro[3.5]nonane?
The canonical SMILES for 7-propylspiro[3.5]nonane is CCCC1CCC2(CCC2)CC1.
What is the InChIKey of 7-propylspiro[3.5]nonane?
The InChIKey is RNUMXNNSBBKWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-2-4-11-5-9-12(10-6-11)7-3-8-12/h11H,2-10H2,1H3.
What are the key properties of 7-propylspiro[3.5]nonane?
7-propylspiro[3.5]nonane has a molecular weight of 166.31 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propylspiro[3.5]nonane is sourced from PubChem (CID 144910869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).