About propane;spiro[3.3]heptane
propane;spiro[3.3]heptane (PubChem CID 176988732) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is propane;spiro[3.3]heptane.
Molecular Properties
| Compound Name | propane;spiro[3.3]heptane |
| PubChem CID | 176988732 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | propane;spiro[3.3]heptane |
| SMILES | C1CC2(C1)CCC2.CCC |
| InChI | InChI=1S/C7H12.C3H8/c1-3-7(4-1)5-2-6-7;1-3-2/h1-6H2;3H2,1-2H3 |
| InChIKey | RBJIZFLDXIXYNL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze propane;spiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;spiro[3.3]heptane?
The IUPAC name of propane;spiro[3.3]heptane (CID 176988732) is propane;spiro[3.3]heptane.
What is the SMILES notation for propane;spiro[3.3]heptane?
The canonical SMILES for propane;spiro[3.3]heptane is C1CC2(C1)CCC2.CCC.
What is the InChIKey of propane;spiro[3.3]heptane?
The InChIKey is RBJIZFLDXIXYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C3H8/c1-3-7(4-1)5-2-6-7;1-3-2/h1-6H2;3H2,1-2H3.
What are the key properties of propane;spiro[3.3]heptane?
propane;spiro[3.3]heptane has a molecular weight of 140.27 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propane;spiro[3.3]heptane is sourced from PubChem (CID 176988732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).