About spiro[4.4]nonane;dihydrochloride
spiro[4.4]nonane;dihydrochloride (PubChem CID 172764572) has the molecular formula C9H18Cl2
and a molecular weight of 197.15 g/mol. Its IUPAC name is spiro[4.4]nonane;dihydrochloride.
Molecular Properties
| Compound Name | spiro[4.4]nonane;dihydrochloride |
| PubChem CID | 172764572 |
| Molecular Formula | C9H18Cl2 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | spiro[4.4]nonane;dihydrochloride |
| SMILES | C1CCC2(C1)CCCC2.Cl.Cl |
| InChI | InChI=1S/C9H16.2ClH/c1-2-6-9(5-1)7-3-4-8-9;;/h1-8H2;2*1H |
| InChIKey | MDFLWMGLWZFLQB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[4.4]nonane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.4]nonane;dihydrochloride?
The IUPAC name of spiro[4.4]nonane;dihydrochloride (CID 172764572) is spiro[4.4]nonane;dihydrochloride.
What is the SMILES notation for spiro[4.4]nonane;dihydrochloride?
The canonical SMILES for spiro[4.4]nonane;dihydrochloride is C1CCC2(C1)CCCC2.Cl.Cl.
What is the InChIKey of spiro[4.4]nonane;dihydrochloride?
The InChIKey is MDFLWMGLWZFLQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.2ClH/c1-2-6-9(5-1)7-3-4-8-9;;/h1-8H2;2*1H.
What are the key properties of spiro[4.4]nonane;dihydrochloride?
spiro[4.4]nonane;dihydrochloride has a molecular weight of 197.15 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.4]nonane;dihydrochloride is sourced from PubChem (CID 172764572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).