About spiro[2.6]nonane;hydrochloride
spiro[2.6]nonane;hydrochloride (PubChem CID 141316852) has the molecular formula C9H17Cl
and a molecular weight of 160.69 g/mol. Its IUPAC name is spiro[2.6]nonane;hydrochloride.
Molecular Properties
| Compound Name | spiro[2.6]nonane;hydrochloride |
| PubChem CID | 141316852 |
| Molecular Formula | C9H17Cl |
| Molecular Weight | 160.69 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | spiro[2.6]nonane;hydrochloride |
| SMILES | C1CCCC2(CC1)CC2.Cl |
| InChI | InChI=1S/C9H16.ClH/c1-2-4-6-9(5-3-1)7-8-9;/h1-8H2;1H |
| InChIKey | GKYPMTYTLJERGU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[2.6]nonane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.6]nonane;hydrochloride?
The IUPAC name of spiro[2.6]nonane;hydrochloride (CID 141316852) is spiro[2.6]nonane;hydrochloride.
What is the SMILES notation for spiro[2.6]nonane;hydrochloride?
The canonical SMILES for spiro[2.6]nonane;hydrochloride is C1CCCC2(CC1)CC2.Cl.
What is the InChIKey of spiro[2.6]nonane;hydrochloride?
The InChIKey is GKYPMTYTLJERGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.ClH/c1-2-4-6-9(5-3-1)7-8-9;/h1-8H2;1H.
What are the key properties of spiro[2.6]nonane;hydrochloride?
spiro[2.6]nonane;hydrochloride has a molecular weight of 160.69 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.6]nonane;hydrochloride is sourced from PubChem (CID 141316852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).