C11H18O4 — CID 142651675
1,2,3,4-tetraoxadispiro[4.2.58.25]pentadecane (PubChem CID 142651675) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1,2,3,4-tetraoxadispiro[4.2.58.25]pentadecane.
| Compound Name | 1,2,3,4-tetraoxadispiro[4.2.58.25]pentadecane |
|---|---|
| PubChem CID | 142651675 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1,2,3,4-tetraoxadispiro[4.2.58.25]pentadecane |
| SMILES | C1CCC2(CC1)CCC1(CC2)OOOO1 |
| InChI | InChI=1S/C11H18O4/c1-2-4-10(5-3-1)6-8-11(9-7-10)12-14-15-13-11/h1-9H2 |
| InChIKey | WZYFKJMORQUFOF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|