C19H32O4 — CID 24939149
7,8,10,11-tetraoxatrispiro[5.2.2.512.39.36]tricosane (PubChem CID 24939149) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 7,8,10,11-tetraoxatrispiro[5.2.2.512.39.36]tricosane.
| Compound Name | 7,8,10,11-tetraoxatrispiro[5.2.2.512.39.36]tricosane |
|---|---|
| PubChem CID | 24939149 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 7,8,10,11-tetraoxatrispiro[5.2.2.512.39.36]tricosane |
| SMILES | C1CCC2(CC1)CCCC1(CCCC3(CCCCC3)OO1)OO2 |
| InChI | InChI=1S/C19H32O4/c1-3-9-17(10-4-1)13-7-15-19(22-20-17)16-8-14-18(21-23-19)11-5-2-6-12-18/h1-16H2 |
| InChIKey | PQOWZGXCVGGSBH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|