C32H54O12Si2 — CID 122391666
19-methyl-19-[2-(19-methyl-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosan-19-yl)ethynyl]-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosane (PubChem CID 122391666) has the molecular formula C32H54O12Si2 and a molecular weight of 686.94 g/mol. Its IUPAC name is 19-methyl-19-[2-(19-methyl-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosan-19-yl)ethynyl]-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosane.
| Compound Name | 19-methyl-19-[2-(19-methyl-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosan-19-yl)ethynyl]-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosane |
|---|---|
| PubChem CID | 122391666 |
| Molecular Formula | C32H54O12Si2 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | 19-methyl-19-[2-(19-methyl-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosan-19-yl)ethynyl]-8,9,17,18,20,21-hexaoxa-19-siladispiro[6.2.610.57]henicosane |
| SMILES | C[Si]1(C#C[Si]2(C)OOC3(CCCCCC3)OOC3(CCCCCC3)OO2)OOC2(CCCCCC2)OOC2(CCCCCC2)OO1 |
| InChI | InChI=1S/C32H54O12Si2/c1-45(41-37-29(19-11-3-4-12-20-29)33-34-30(38-42-45)21-13-5-6-14-22-30)27-28-46(2)43-39-31(23-15-7-8-16-24-31)35-36-32(40-44-46)25-17-9-10-18-26-32/h3-26H2,1-2H3 |
| InChIKey | YXDBVIOEQSDGBU-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|