C15H25NO4 — CID 15946638
N-cyclopropyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine (PubChem CID 15946638) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-cyclopropyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine.
| Compound Name | N-cyclopropyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine |
|---|---|
| PubChem CID | 15946638 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-cyclopropyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine |
| SMILES | C1CCC2(CC1)OOC1(CCC(NC3CC3)CC1)OO2 |
| InChI | InChI=1S/C15H25NO4/c1-2-8-14(9-3-1)17-19-15(20-18-14)10-6-13(7-11-15)16-12-4-5-12/h12-13,16H,1-11H2 |
| InChIKey | BTXWQDYTURCZFP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|