C14H22O6 — CID 171402327
7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl acetate (PubChem CID 171402327) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl acetate.
| Compound Name | 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl acetate |
|---|---|
| PubChem CID | 171402327 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-yl acetate |
| SMILES | CC(=O)OC1CCC2(CC1)OOC1(CCCCC1)OO2 |
| InChI | InChI=1S/C14H22O6/c1-11(15)16-12-5-9-14(10-6-12)19-17-13(18-20-14)7-3-2-4-8-13/h12H,2-10H2,1H3 |
| InChIKey | URKYKYYCKGQCBA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|