C20H30O8 — CID 132504551
[(E)-5-acetyloxypent-3-enyl] 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane-12-carboxylate (PubChem CID 132504551) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is [(E)-5-acetyloxypent-3-enyl] 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane-12-carboxylate.
| Compound Name | [(E)-5-acetyloxypent-3-enyl] 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane-12-carboxylate |
|---|---|
| PubChem CID | 132504551 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(E)-5-acetyloxypent-3-enyl] 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane-12-carboxylate |
| SMILES | CC(=O)OC/C=C/CCOC(=O)C1CCC2(CC1)OOC1(CCCCC1)OO2 |
| InChI | InChI=1S/C20H30O8/c1-16(21)23-14-6-3-7-15-24-18(22)17-8-12-20(13-9-17)27-25-19(26-28-20)10-4-2-5-11-19/h3,6,17H,2,4-5,7-15H2,1H3/b6-3+ |
| InChIKey | UTYQVVNCMQMHFI-ZZXKWVIFSA-N |
| XLogP | 3.50 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|