About 6-acetyloxyhex-4-enoic acid
6-acetyloxyhex-4-enoic acid (PubChem CID 54335921) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 6-acetyloxyhex-4-enoic acid.
Molecular Properties
| Compound Name | 6-acetyloxyhex-4-enoic acid |
| PubChem CID | 54335921 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 6-acetyloxyhex-4-enoic acid |
| SMILES | CC(=O)OCC=CCCC(=O)O |
| InChI | InChI=1S/C8H12O4/c1-7(9)12-6-4-2-3-5-8(10)11/h2,4H,3,5-6H2,1H3,(H,10,11) |
| InChIKey | TVLMERTURHBRHH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-acetyloxyhex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyloxyhex-4-enoic acid?
The IUPAC name of 6-acetyloxyhex-4-enoic acid (CID 54335921) is 6-acetyloxyhex-4-enoic acid.
What is the SMILES notation for 6-acetyloxyhex-4-enoic acid?
The canonical SMILES for 6-acetyloxyhex-4-enoic acid is CC(=O)OCC=CCCC(=O)O.
What is the InChIKey of 6-acetyloxyhex-4-enoic acid?
The InChIKey is TVLMERTURHBRHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-7(9)12-6-4-2-3-5-8(10)11/h2,4H,3,5-6H2,1H3,(H,10,11).
What are the key properties of 6-acetyloxyhex-4-enoic acid?
6-acetyloxyhex-4-enoic acid has a molecular weight of 172.18 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyloxyhex-4-enoic acid is sourced from PubChem (CID 54335921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).