About 4-hydroxybut-2-enyl acetate
4-hydroxybut-2-enyl acetate (PubChem CID 54073989) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is 4-hydroxybut-2-enyl acetate.
Molecular Properties
| Compound Name | 4-hydroxybut-2-enyl acetate |
| PubChem CID | 54073989 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 4-hydroxybut-2-enyl acetate |
| SMILES | CC(=O)OCC=CCO |
| InChI | InChI=1S/C6H10O3/c1-6(8)9-5-3-2-4-7/h2-3,7H,4-5H2,1H3 |
| InChIKey | MIKNOVPHRJOEBB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybut-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybut-2-enyl acetate?
The IUPAC name of 4-hydroxybut-2-enyl acetate (CID 54073989) is 4-hydroxybut-2-enyl acetate.
What is the SMILES notation for 4-hydroxybut-2-enyl acetate?
The canonical SMILES for 4-hydroxybut-2-enyl acetate is CC(=O)OCC=CCO.
What is the InChIKey of 4-hydroxybut-2-enyl acetate?
The InChIKey is MIKNOVPHRJOEBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-6(8)9-5-3-2-4-7/h2-3,7H,4-5H2,1H3.
What are the key properties of 4-hydroxybut-2-enyl acetate?
4-hydroxybut-2-enyl acetate has a molecular weight of 130.14 g/mol, XLogP of 0.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybut-2-enyl acetate is sourced from PubChem (CID 54073989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).