(Z)-9-oxodec-4-enoic acid

C10H16O3 — CID 12893742

IUPAC(Z)-9-oxodec-4-enoic acid
SMILESCC(=O)CCC/C=C\CCC(=O)O
InChIInChI=1S/C10H16O3/c1-9(11)7-5-3-2-4-6-8-10(12)13/h2,4H,3,5-8H2,1H3,(H,12,13)/b4-2-
InChIKeyZZZRWWSUKLARAW-RQOWECAXSA-N
MW184.23 g/mol
LogP2.17
Rot. Bonds7

About (Z)-9-oxodec-4-enoic acid

(Z)-9-oxodec-4-enoic acid (PubChem CID 12893742) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (Z)-9-oxodec-4-enoic acid.

Molecular Properties

Compound Name(Z)-9-oxodec-4-enoic acid
PubChem CID12893742
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Name(Z)-9-oxodec-4-enoic acid
SMILESCC(=O)CCC/C=C\CCC(=O)O
InChIInChI=1S/C10H16O3/c1-9(11)7-5-3-2-4-6-8-10(12)13/h2,4H,3,5-8H2,1H3,(H,12,13)/b4-2-
InChIKeyZZZRWWSUKLARAW-RQOWECAXSA-N
XLogP2.17
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-9-oxodec-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-9-oxodec-4-enoic acid?
The IUPAC name of (Z)-9-oxodec-4-enoic acid (CID 12893742) is (Z)-9-oxodec-4-enoic acid.
What is the SMILES notation for (Z)-9-oxodec-4-enoic acid?
The canonical SMILES for (Z)-9-oxodec-4-enoic acid is CC(=O)CCC/C=C\CCC(=O)O.
What is the InChIKey of (Z)-9-oxodec-4-enoic acid?
The InChIKey is ZZZRWWSUKLARAW-RQOWECAXSA-N. The full InChI is InChI=1S/C10H16O3/c1-9(11)7-5-3-2-4-6-8-10(12)13/h2,4H,3,5-8H2,1H3,(H,12,13)/b4-2-.
What are the key properties of (Z)-9-oxodec-4-enoic acid?
(Z)-9-oxodec-4-enoic acid has a molecular weight of 184.23 g/mol, XLogP of 2.17, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-9-oxodec-4-enoic acid is sourced from PubChem (CID 12893742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).