(E)-8-aminooct-4-enoic acid

C8H15NO2 — CID 6365538

IUPAC(E)-8-aminooct-4-enoic acid
SMILESNCCC/C=C/CCC(=O)O
InChIInChI=1S/C8H15NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-2H,3-7,9H2,(H,10,11)/b2-1+
InChIKeyVIBUBBGZNCHOEE-OWOJBTEDSA-N
MW157.21 g/mol
LogP1.15
Rot. Bonds6

About (E)-8-aminooct-4-enoic acid

(E)-8-aminooct-4-enoic acid (PubChem CID 6365538) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (E)-8-aminooct-4-enoic acid.

Molecular Properties

Compound Name(E)-8-aminooct-4-enoic acid
PubChem CID6365538
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name(E)-8-aminooct-4-enoic acid
SMILESNCCC/C=C/CCC(=O)O
InChIInChI=1S/C8H15NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-2H,3-7,9H2,(H,10,11)/b2-1+
InChIKeyVIBUBBGZNCHOEE-OWOJBTEDSA-N
XLogP1.15
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 51.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-8-aminooct-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-8-aminooct-4-enoic acid?
The IUPAC name of (E)-8-aminooct-4-enoic acid (CID 6365538) is (E)-8-aminooct-4-enoic acid.
What is the SMILES notation for (E)-8-aminooct-4-enoic acid?
The canonical SMILES for (E)-8-aminooct-4-enoic acid is NCCC/C=C/CCC(=O)O.
What is the InChIKey of (E)-8-aminooct-4-enoic acid?
The InChIKey is VIBUBBGZNCHOEE-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H15NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-2H,3-7,9H2,(H,10,11)/b2-1+.
What are the key properties of (E)-8-aminooct-4-enoic acid?
(E)-8-aminooct-4-enoic acid has a molecular weight of 157.21 g/mol, XLogP of 1.15, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-aminooct-4-enoic acid is sourced from PubChem (CID 6365538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).