(E)-10-oxodec-4-enoic acid

C10H16O3 — CID 6365679

IUPAC(E)-10-oxodec-4-enoic acid
SMILESO=CCCCC/C=C/CCC(=O)O
InChIInChI=1S/C10H16O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h2,4,9H,1,3,5-8H2,(H,12,13)/b4-2+
InChIKeyRMWKFDCOCADQIU-DUXPYHPUSA-N
MW184.23 g/mol
LogP2.17
Rot. Bonds8

About (E)-10-oxodec-4-enoic acid

(E)-10-oxodec-4-enoic acid (PubChem CID 6365679) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (E)-10-oxodec-4-enoic acid.

Molecular Properties

Compound Name(E)-10-oxodec-4-enoic acid
PubChem CID6365679
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Name(E)-10-oxodec-4-enoic acid
SMILESO=CCCCC/C=C/CCC(=O)O
InChIInChI=1S/C10H16O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h2,4,9H,1,3,5-8H2,(H,12,13)/b4-2+
InChIKeyRMWKFDCOCADQIU-DUXPYHPUSA-N
XLogP2.17
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-10-oxodec-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-10-oxodec-4-enoic acid?
The IUPAC name of (E)-10-oxodec-4-enoic acid (CID 6365679) is (E)-10-oxodec-4-enoic acid.
What is the SMILES notation for (E)-10-oxodec-4-enoic acid?
The canonical SMILES for (E)-10-oxodec-4-enoic acid is O=CCCCC/C=C/CCC(=O)O.
What is the InChIKey of (E)-10-oxodec-4-enoic acid?
The InChIKey is RMWKFDCOCADQIU-DUXPYHPUSA-N. The full InChI is InChI=1S/C10H16O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h2,4,9H,1,3,5-8H2,(H,12,13)/b4-2+.
What are the key properties of (E)-10-oxodec-4-enoic acid?
(E)-10-oxodec-4-enoic acid has a molecular weight of 184.23 g/mol, XLogP of 2.17, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-10-oxodec-4-enoic acid is sourced from PubChem (CID 6365679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).