C10H17NO2 — CID 123700269
10-aminodeca-3,6-dienoic acid (PubChem CID 123700269) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 10-aminodeca-3,6-dienoic acid.
| Compound Name | 10-aminodeca-3,6-dienoic acid |
|---|---|
| PubChem CID | 123700269 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 10-aminodeca-3,6-dienoic acid |
| SMILES | NCCCC=CCC=CCC(=O)O |
| InChI | InChI=1S/C10H17NO2/c11-9-7-5-3-1-2-4-6-8-10(12)13/h1,3-4,6H,2,5,7-9,11H2,(H,12,13) |
| InChIKey | OMBTTYHIKUHFHC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|