C12H20O3 — CID 5312748
(3Z,6Z)-12-hydroxydodeca-3,6-dienoic acid (PubChem CID 5312748) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3Z,6Z)-12-hydroxydodeca-3,6-dienoic acid.
| Compound Name | (3Z,6Z)-12-hydroxydodeca-3,6-dienoic acid |
|---|---|
| PubChem CID | 5312748 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3Z,6Z)-12-hydroxydodeca-3,6-dienoic acid |
| SMILES | O=C(O)C/C=C\C/C=C\CCCCCO |
| InChI | InChI=1S/C12H20O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-2,6,8,13H,3-5,7,9-11H2,(H,14,15)/b2-1-,8-6- |
| InChIKey | BSWDOBLGMLCOJP-NGNAIVRQSA-N |
| XLogP | 2.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|