C10H16O4 — CID 45037040
1,4-dioxaspiro[4.5]decan-8-yl acetate (PubChem CID 45037040) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decan-8-yl acetate.
| Compound Name | 1,4-dioxaspiro[4.5]decan-8-yl acetate |
|---|---|
| PubChem CID | 45037040 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decan-8-yl acetate |
| SMILES | CC(=O)OC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H16O4/c1-8(11)14-9-2-4-10(5-3-9)12-6-7-13-10/h9H,2-7H2,1H3 |
| InChIKey | AWDZDJSARGZRJI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |