About 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide
4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide (PubChem CID 113414160) has the molecular formula C14H25NO4
and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide |
| PubChem CID | 113414160 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H25NO4/c1-15(2)13(16)4-3-9-17-12-5-7-14(8-6-12)18-10-11-19-14/h12H,3-11H2,1-2H3 |
| InChIKey | FJZXKSZJFHILJO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide?
The IUPAC name of 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide (CID 113414160) is 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide.
What is the SMILES notation for 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide?
The canonical SMILES for 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide is CN(C)C(=O)CCCOC1CCC2(CC1)OCCO2.
What is the InChIKey of 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide?
The InChIKey is FJZXKSZJFHILJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO4/c1-15(2)13(16)4-3-9-17-12-5-7-14(8-6-12)18-10-11-19-14/h12H,3-11H2,1-2H3.
What are the key properties of 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide?
4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide has a molecular weight of 271.36 g/mol, XLogP of 1.56, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide is sourced from PubChem (CID 113414160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).