C14H25NO4 — CID 113414160
4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide (PubChem CID 113414160) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide.
| Compound Name | 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 113414160 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H25NO4/c1-15(2)13(16)4-3-9-17-12-5-7-14(8-6-12)18-10-11-19-14/h12H,3-11H2,1-2H3 |
| InChIKey | FJZXKSZJFHILJO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|