C14H26O5 — CID 103409869
8-[3-(2-methoxyethoxy)propoxy]-1,4-dioxaspiro[4.5]decane (PubChem CID 103409869) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 8-[3-(2-methoxyethoxy)propoxy]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[3-(2-methoxyethoxy)propoxy]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 103409869 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 8-[3-(2-methoxyethoxy)propoxy]-1,4-dioxaspiro[4.5]decane |
| SMILES | COCCOCCCOC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H26O5/c1-15-9-10-16-7-2-8-17-13-3-5-14(6-4-13)18-11-12-19-14/h13H,2-12H2,1H3 |
| InChIKey | POWJXINKLBYLLO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|